| assay | ≥98% (HPLC) |
| form | powder |
| composition | H2O, 0-4 mol/mol (moles per mole of product) |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| web metadata keyword.default | 3-(4-Chloro-2-fluorobenzyl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)-8-(morpholinomethyl)imidazo[1,2-b]pyridazin-6-amine for research,JAK2-selective inhibitor LY2784544 for cancer studies,LY2784544 1229236-86-5 CAS number,LY2784544 ATP-competitive kinase inhibitor,LY2784544 JAK2 inhibitor for drug discovery,LY2784544 JAK2 inhibitor,LY2784544 chemical structure and applications,LY2784544 for laboratory use,LY2784544 for oncology research,LY2784544 high purity for pharmacological studies,LY2784544 janus kinase inhibitor for clinical trials,LY2784544 potency and efficacy in JAK2V617F models,LY2784544 procurement for biotech applications |
| storage temp. | 2-8°C |
| SMILES string | Fc1c(ccc(c1)Cl)Cc2[n]3c(nc2C)C(=CC(=N3)Nc5n[nH]c(c5)C)CN4CCOCC4 |
| InChI | 1S/C23H25ClFN7O/c1-14-9-21(29-28-14)27-22-11-17(13-31-5-7-33-8-6-31)23-26-15(2)20(32(23)30-22)10-16-3-4-18(24)12-19(16)25/h3-4,9,11-12H,5-8,10,13H2,1-2H3,(H2,27,28,29,30) |
| InChI key | SQSZANZGUXWJEA-UHFFFAOYSA-N |